C14H14FN3 — CID 107883313
2-fluoro-5-[[3-(methylaminomethyl)pyrrol-1-yl]methyl]benzonitrile (PubChem CID 107883313) has the molecular formula C14H14FN3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-fluoro-5-[[3-(methylaminomethyl)pyrrol-1-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[3-(methylaminomethyl)pyrrol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 107883313 |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-fluoro-5-[[3-(methylaminomethyl)pyrrol-1-yl]methyl]benzonitrile |
| SMILES | CNCc1ccn(Cc2ccc(F)c(C#N)c2)c1 |
| InChI | InChI=1S/C14H14FN3/c1-17-8-12-4-5-18(10-12)9-11-2-3-14(15)13(6-11)7-16/h2-6,10,17H,8-9H2,1H3 |
| InChIKey | JSHHZIKUEPAQHS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |