C10H12FN3 — CID 107880389
5-[(2,2-dimethylhydrazinyl)methyl]-2-fluorobenzonitrile (PubChem CID 107880389) has the molecular formula C10H12FN3 and a molecular weight of 193.22 g/mol. Its IUPAC name is 5-[(2,2-dimethylhydrazinyl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,2-dimethylhydrazinyl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107880389 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 5-[(2,2-dimethylhydrazinyl)methyl]-2-fluorobenzonitrile |
| SMILES | CN(C)NCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C10H12FN3/c1-14(2)13-7-8-3-4-10(11)9(5-8)6-12/h3-5,13H,7H2,1-2H3 |
| InChIKey | XLBRBFIPAXHBCY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|