C12H12ClF3O2 — CID 107884141
1-(4-chloro-3-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-one (PubChem CID 107884141) has the molecular formula C12H12ClF3O2 and a molecular weight of 280.67 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-one |
|---|---|
| PubChem CID | 107884141 |
| Molecular Formula | C12H12ClF3O2 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-one |
| SMILES | O=C(CCOCC(F)F)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H12ClF3O2/c13-10-2-1-8(6-11(10)14)5-9(17)3-4-18-7-12(15)16/h1-2,6,12H,3-5,7H2 |
| InChIKey | NBXBCTHBABSNPU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|