C25H26F2N2O2 — CID 10788455
N-[2-[2-[bis(4-fluorophenyl)methoxy]ethylamino]ethyl]-2-phenylacetamide (PubChem CID 10788455) has the molecular formula C25H26F2N2O2 and a molecular weight of 424.49 g/mol. Its IUPAC name is N-[2-[2-[bis(4-fluorophenyl)methoxy]ethylamino]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-[2-[bis(4-fluorophenyl)methoxy]ethylamino]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10788455 |
| Molecular Formula | C25H26F2N2O2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[2-[2-[bis(4-fluorophenyl)methoxy]ethylamino]ethyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCCNCCOC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H26F2N2O2/c26-22-10-6-20(7-11-22)25(21-8-12-23(27)13-9-21)31-17-16-28-14-15-29-24(30)18-19-4-2-1-3-5-19/h1-13,25,28H,14-18H2,(H,29,30) |
| InChIKey | ZOVQSSMFGDAFDJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|