C19H22O2 — CID 107885344
4-(2-pentan-2-yloxynaphthalen-1-yl)but-3-yn-1-ol (PubChem CID 107885344) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-(2-pentan-2-yloxynaphthalen-1-yl)but-3-yn-1-ol.
| Compound Name | 4-(2-pentan-2-yloxynaphthalen-1-yl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 107885344 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-(2-pentan-2-yloxynaphthalen-1-yl)but-3-yn-1-ol |
| SMILES | CCCC(C)Oc1ccc2ccccc2c1C#CCCO |
| InChI | InChI=1S/C19H22O2/c1-3-8-15(2)21-19-13-12-16-9-4-5-10-17(16)18(19)11-6-7-14-20/h4-5,9-10,12-13,15,20H,3,7-8,14H2,1-2H3 |
| InChIKey | DUIVILBEWRPWTF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|