C17H28BrN — CID 107887110
2-(3-bromophenyl)-3-methyl-N-(2-methylpropyl)hexan-1-amine (PubChem CID 107887110) has the molecular formula C17H28BrN and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-methyl-N-(2-methylpropyl)hexan-1-amine.
| Compound Name | 2-(3-bromophenyl)-3-methyl-N-(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 107887110 |
| Molecular Formula | C17H28BrN |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(3-bromophenyl)-3-methyl-N-(2-methylpropyl)hexan-1-amine |
| SMILES | CCCC(C)C(CNCC(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H28BrN/c1-5-7-14(4)17(12-19-11-13(2)3)15-8-6-9-16(18)10-15/h6,8-10,13-14,17,19H,5,7,11-12H2,1-4H3 |
| InChIKey | YPIDZIPNFXSTDT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |