C15H23ClFN — CID 107887203
2-(2-chloro-4-fluorophenyl)-N-ethyl-3-methylhexan-1-amine (PubChem CID 107887203) has the molecular formula C15H23ClFN and a molecular weight of 271.81 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-N-ethyl-3-methylhexan-1-amine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-N-ethyl-3-methylhexan-1-amine |
|---|---|
| PubChem CID | 107887203 |
| Molecular Formula | C15H23ClFN |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-N-ethyl-3-methylhexan-1-amine |
| SMILES | CCCC(C)C(CNCC)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H23ClFN/c1-4-6-11(3)14(10-18-5-2)13-8-7-12(17)9-15(13)16/h7-9,11,14,18H,4-6,10H2,1-3H3 |
| InChIKey | QISCUGUGVWRJBL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |