C16H25Cl2N — CID 107886981
2-(2,4-dichlorophenyl)-3-methyl-N-propylhexan-1-amine (PubChem CID 107886981) has the molecular formula C16H25Cl2N and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-methyl-N-propylhexan-1-amine.
| Compound Name | 2-(2,4-dichlorophenyl)-3-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 107886981 |
| Molecular Formula | C16H25Cl2N |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-methyl-N-propylhexan-1-amine |
| SMILES | CCCNCC(c1ccc(Cl)cc1Cl)C(C)CCC |
| InChI | InChI=1S/C16H25Cl2N/c1-4-6-12(3)15(11-19-9-5-2)14-8-7-13(17)10-16(14)18/h7-8,10,12,15,19H,4-6,9,11H2,1-3H3 |
| InChIKey | KMJDKKYPDRMJHQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|