C16H26BrN — CID 114012929
2-(2-bromophenyl)-3-methyl-N-propylhexan-1-amine (PubChem CID 114012929) has the molecular formula C16H26BrN and a molecular weight of 312.30 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3-methyl-N-propylhexan-1-amine.
| Compound Name | 2-(2-bromophenyl)-3-methyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 114012929 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(2-bromophenyl)-3-methyl-N-propylhexan-1-amine |
| SMILES | CCCNCC(c1ccccc1Br)C(C)CCC |
| InChI | InChI=1S/C16H26BrN/c1-4-8-13(3)15(12-18-11-5-2)14-9-6-7-10-16(14)17/h6-7,9-10,13,15,18H,4-5,8,11-12H2,1-3H3 |
| InChIKey | BJRBPWVTPDKKAR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|