C17H28BrN — CID 107887186
2-(2-bromophenyl)-N-tert-butyl-3-methylhexan-1-amine (PubChem CID 107887186) has the molecular formula C17H28BrN and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-tert-butyl-3-methylhexan-1-amine.
| Compound Name | 2-(2-bromophenyl)-N-tert-butyl-3-methylhexan-1-amine |
|---|---|
| PubChem CID | 107887186 |
| Molecular Formula | C17H28BrN |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(2-bromophenyl)-N-tert-butyl-3-methylhexan-1-amine |
| SMILES | CCCC(C)C(CNC(C)(C)C)c1ccccc1Br |
| InChI | InChI=1S/C17H28BrN/c1-6-9-13(2)15(12-19-17(3,4)5)14-10-7-8-11-16(14)18/h7-8,10-11,13,15,19H,6,9,12H2,1-5H3 |
| InChIKey | OHJCPVGEPAXGIU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |