C17H22BrNO — CID 79448849
N-[2-(2-bromophenyl)-3-(furan-2-yl)propyl]-2-methylpropan-2-amine (PubChem CID 79448849) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)-3-(furan-2-yl)propyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-(2-bromophenyl)-3-(furan-2-yl)propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 79448849 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[2-(2-bromophenyl)-3-(furan-2-yl)propyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC(Cc1ccco1)c1ccccc1Br |
| InChI | InChI=1S/C17H22BrNO/c1-17(2,3)19-12-13(11-14-7-6-10-20-14)15-8-4-5-9-16(15)18/h4-10,13,19H,11-12H2,1-3H3 |
| InChIKey | SYZMGDOJTIWXKH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |