C18H25NO — CID 79421182
N-[3-(furan-2-yl)-2-(2-methylphenyl)propyl]-2-methylpropan-2-amine (PubChem CID 79421182) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-2-(2-methylphenyl)propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-(furan-2-yl)-2-(2-methylphenyl)propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 79421182 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[3-(furan-2-yl)-2-(2-methylphenyl)propyl]-2-methylpropan-2-amine |
| SMILES | Cc1ccccc1C(CNC(C)(C)C)Cc1ccco1 |
| InChI | InChI=1S/C18H25NO/c1-14-8-5-6-10-17(14)15(13-19-18(2,3)4)12-16-9-7-11-20-16/h5-11,15,19H,12-13H2,1-4H3 |
| InChIKey | UTYFSAUOKCCUKR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |