C12H13Cl2F — CID 107888265
1-chloro-4-[(3-chlorocyclopentyl)methyl]-2-fluorobenzene (PubChem CID 107888265) has the molecular formula C12H13Cl2F and a molecular weight of 247.14 g/mol. Its IUPAC name is 1-chloro-4-[(3-chlorocyclopentyl)methyl]-2-fluorobenzene.
| Compound Name | 1-chloro-4-[(3-chlorocyclopentyl)methyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 107888265 |
| Molecular Formula | C12H13Cl2F |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-chloro-4-[(3-chlorocyclopentyl)methyl]-2-fluorobenzene |
| SMILES | Fc1cc(CC2CCC(Cl)C2)ccc1Cl |
| InChI | InChI=1S/C12H13Cl2F/c13-10-3-1-8(6-10)5-9-2-4-11(14)12(15)7-9/h2,4,7-8,10H,1,3,5-6H2 |
| InChIKey | WYSISMYTEDVFNX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|