C12H23NO — CID 107889216
3-(2,3-dimethylhex-2-enyl)morpholine (PubChem CID 107889216) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-(2,3-dimethylhex-2-enyl)morpholine.
| Compound Name | 3-(2,3-dimethylhex-2-enyl)morpholine |
|---|---|
| PubChem CID | 107889216 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-(2,3-dimethylhex-2-enyl)morpholine |
| SMILES | CCCC(C)=C(C)CC1COCCN1 |
| InChI | InChI=1S/C12H23NO/c1-4-5-10(2)11(3)8-12-9-14-7-6-13-12/h12-13H,4-9H2,1-3H3 |
| InChIKey | IBCPSUVBFMTLDL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|