About 2-morpholin-3-ylacetic acid;hydrochloride
2-morpholin-3-ylacetic acid;hydrochloride (PubChem CID 13099576) has the molecular formula C6H12ClNO3
and a molecular weight of 181.62 g/mol. Its IUPAC name is 2-morpholin-3-ylacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-3-ylacetic acid;hydrochloride |
| PubChem CID | 13099576 |
| Molecular Formula | C6H12ClNO3 |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-morpholin-3-ylacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CC1COCCN1 |
| InChI | InChI=1S/C6H11NO3.ClH/c8-6(9)3-5-4-10-2-1-7-5;/h5,7H,1-4H2,(H,8,9);1H |
| InChIKey | LFOMNFLGCFFCQJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-morpholin-3-ylacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-3-ylacetic acid;hydrochloride?
The IUPAC name of 2-morpholin-3-ylacetic acid;hydrochloride (CID 13099576) is 2-morpholin-3-ylacetic acid;hydrochloride.
What is the SMILES notation for 2-morpholin-3-ylacetic acid;hydrochloride?
The canonical SMILES for 2-morpholin-3-ylacetic acid;hydrochloride is Cl.O=C(O)CC1COCCN1.
What is the InChIKey of 2-morpholin-3-ylacetic acid;hydrochloride?
The InChIKey is LFOMNFLGCFFCQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3.ClH/c8-6(9)3-5-4-10-2-1-7-5;/h5,7H,1-4H2,(H,8,9);1H.
What are the key properties of 2-morpholin-3-ylacetic acid;hydrochloride?
2-morpholin-3-ylacetic acid;hydrochloride has a molecular weight of 181.62 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-3-ylacetic acid;hydrochloride is sourced from PubChem (CID 13099576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).