C8H15N3O4 — CID 112674067
N-(2-amino-2-oxoethoxy)-2-morpholin-3-ylacetamide (PubChem CID 112674067) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2-morpholin-3-ylacetamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2-morpholin-3-ylacetamide |
|---|---|
| PubChem CID | 112674067 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2-morpholin-3-ylacetamide |
| SMILES | NC(=O)CONC(=O)CC1COCCN1 |
| InChI | InChI=1S/C8H15N3O4/c9-7(12)5-15-11-8(13)3-6-4-14-2-1-10-6/h6,10H,1-5H2,(H2,9,12)(H,11,13) |
| InChIKey | SGPIAHLNRCSYGU-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|