C15H18ClFO2 — CID 107890536
1-(4-chloro-3-fluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-one (PubChem CID 107890536) has the molecular formula C15H18ClFO2 and a molecular weight of 284.76 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-one |
|---|---|
| PubChem CID | 107890536 |
| Molecular Formula | C15H18ClFO2 |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-(3-ethoxycyclobutyl)propan-2-one |
| SMILES | CCOC1CC(CC(=O)Cc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C15H18ClFO2/c1-2-19-13-7-11(8-13)6-12(18)5-10-3-4-14(16)15(17)9-10/h3-4,9,11,13H,2,5-8H2,1H3 |
| InChIKey | ZHGPEULPOZBAEK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |