C24H39NOSe — CID 10789068
(1R,2S,5R)-5-methyl-2-[2-[[(2S)-4-methylpent-3-en-2-yl]-(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol (PubChem CID 10789068) has the molecular formula C24H39NOSe and a molecular weight of 436.54 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-2-[2-[[(2S)-4-methylpent-3-en-2-yl]-(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-5-methyl-2-[2-[[(2S)-4-methylpent-3-en-2-yl]-(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 10789068 |
| Molecular Formula | C24H39NOSe |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (1R,2S,5R)-5-methyl-2-[2-[[(2S)-4-methylpent-3-en-2-yl]-(2-phenylselanylethyl)amino]propan-2-yl]cyclohexan-1-ol |
| SMILES | CC(C)=C[C@H](C)N(CC[Se]c1ccccc1)C(C)(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C24H39NOSe/c1-18(2)16-20(4)25(14-15-27-21-10-8-7-9-11-21)24(5,6)22-13-12-19(3)17-23(22)26/h7-11,16,19-20,22-23,26H,12-15,17H2,1-6H3/t19-,20+,22-,23-/m1/s1 |
| InChIKey | JJOKIUAKCINHLM-IRMYBRCSSA-N |
| XLogP | 4.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|