C18H27N3O8S — CID 10789493
3-ethoxypropyl 3-(hydroxycarbamoyl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 10789493) has the molecular formula C18H27N3O8S and a molecular weight of 445.49 g/mol. Its IUPAC name is 3-ethoxypropyl 3-(hydroxycarbamoyl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | 3-ethoxypropyl 3-(hydroxycarbamoyl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 10789493 |
| Molecular Formula | C18H27N3O8S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-ethoxypropyl 3-(hydroxycarbamoyl)-4-(4-methoxyphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCOCCCOC(=O)N1CCN(S(=O)(=O)c2ccc(OC)cc2)C(C(=O)NO)C1 |
| InChI | InChI=1S/C18H27N3O8S/c1-3-28-11-4-12-29-18(23)20-9-10-21(16(13-20)17(22)19-24)30(25,26)15-7-5-14(27-2)6-8-15/h5-8,16,24H,3-4,9-13H2,1-2H3,(H,19,22) |
| InChIKey | QYFKTMNLZHLRIH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|