C13H18ClFO — CID 107895015
2-[(4-chloro-3-fluorophenyl)methyl]-2,3-dimethylbutan-1-ol (PubChem CID 107895015) has the molecular formula C13H18ClFO and a molecular weight of 244.74 g/mol. Its IUPAC name is 2-[(4-chloro-3-fluorophenyl)methyl]-2,3-dimethylbutan-1-ol.
| Compound Name | 2-[(4-chloro-3-fluorophenyl)methyl]-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 107895015 |
| Molecular Formula | C13H18ClFO |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-[(4-chloro-3-fluorophenyl)methyl]-2,3-dimethylbutan-1-ol |
| SMILES | CC(C)C(C)(CO)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H18ClFO/c1-9(2)13(3,8-16)7-10-4-5-11(14)12(15)6-10/h4-6,9,16H,7-8H2,1-3H3 |
| InChIKey | SDTROACVUOSSNM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |