C7H12FI2O3P — CID 10789609
(E)-1-diethoxyphosphoryl-1-fluoro-2,3-diiodoprop-1-ene (PubChem CID 10789609) has the molecular formula C7H12FI2O3P and a molecular weight of 447.95 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-1-fluoro-2,3-diiodoprop-1-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-1-fluoro-2,3-diiodoprop-1-ene |
|---|---|
| PubChem CID | 10789609 |
| Molecular Formula | C7H12FI2O3P |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-1-fluoro-2,3-diiodoprop-1-ene |
| SMILES | CCOP(=O)(OCC)/C(F)=C(/I)CI |
| InChI | InChI=1S/C7H12FI2O3P/c1-3-12-14(11,13-4-2)7(8)6(10)5-9/h3-5H2,1-2H3/b7-6+ |
| InChIKey | DZQOPSVAOBEJBS-VOTSOKGWSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|