C11H25NS — CID 107896520
N,3-dimethyl-1-propan-2-ylsulfanylhexan-2-amine (PubChem CID 107896520) has the molecular formula C11H25NS and a molecular weight of 203.39 g/mol. Its IUPAC name is N,3-dimethyl-1-propan-2-ylsulfanylhexan-2-amine.
| Compound Name | N,3-dimethyl-1-propan-2-ylsulfanylhexan-2-amine |
|---|---|
| PubChem CID | 107896520 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N,3-dimethyl-1-propan-2-ylsulfanylhexan-2-amine |
| SMILES | CCCC(C)C(CSC(C)C)NC |
| InChI | InChI=1S/C11H25NS/c1-6-7-10(4)11(12-5)8-13-9(2)3/h9-12H,6-8H2,1-5H3 |
| InChIKey | UZHMWDSTMNQDMO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |