About 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane
1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane (PubChem CID 107898171) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane |
| PubChem CID | 107898171 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane |
| SMILES | C/C=C/CN1CC(C)(c2ccccc2)NCCC1C |
| InChI | InChI=1S/C17H26N2/c1-4-5-13-19-14-17(3,18-12-11-15(19)2)16-9-7-6-8-10-16/h4-10,15,18H,11-14H2,1-3H3/b5-4+ |
| InChIKey | HXUPNKHHHOPXKA-SNAWJCMRSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane?
The IUPAC name of 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane (CID 107898171) is 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane.
What is the SMILES notation for 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane?
The canonical SMILES for 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane is C/C=C/CN1CC(C)(c2ccccc2)NCCC1C.
What is the InChIKey of 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane?
The InChIKey is HXUPNKHHHOPXKA-SNAWJCMRSA-N. The full InChI is InChI=1S/C17H26N2/c1-4-5-13-19-14-17(3,18-12-11-15(19)2)16-9-7-6-8-10-16/h4-10,15,18H,11-14H2,1-3H3/b5-4+.
What are the key properties of 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane?
1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane has a molecular weight of 258.41 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-2-enyl]-3,7-dimethyl-3-phenyl-1,4-diazepane is sourced from PubChem (CID 107898171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).