C6H12ClNO2 — CID 107900017
2-[[(E)-3-chloroprop-2-enyl]amino]propane-1,3-diol (PubChem CID 107900017) has the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. Its IUPAC name is 2-[[(E)-3-chloroprop-2-enyl]amino]propane-1,3-diol.
| Compound Name | 2-[[(E)-3-chloroprop-2-enyl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 107900017 |
| Molecular Formula | C6H12ClNO2 |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-[[(E)-3-chloroprop-2-enyl]amino]propane-1,3-diol |
| SMILES | OCC(CO)NC/C=C/Cl |
| InChI | InChI=1S/C6H12ClNO2/c7-2-1-3-8-6(4-9)5-10/h1-2,6,8-10H,3-5H2/b2-1+ |
| InChIKey | NVQHRBXOLBAMRL-OWOJBTEDSA-N |
| XLogP | -0.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |