C12H19ClO — CID 107900844
2-[(E)-3-chloroprop-2-enyl]-4-propan-2-ylcyclohexan-1-one (PubChem CID 107900844) has the molecular formula C12H19ClO and a molecular weight of 214.74 g/mol. Its IUPAC name is 2-[(E)-3-chloroprop-2-enyl]-4-propan-2-ylcyclohexan-1-one.
| Compound Name | 2-[(E)-3-chloroprop-2-enyl]-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 107900844 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-[(E)-3-chloroprop-2-enyl]-4-propan-2-ylcyclohexan-1-one |
| SMILES | CC(C)C1CCC(=O)C(C/C=C/Cl)C1 |
| InChI | InChI=1S/C12H19ClO/c1-9(2)10-5-6-12(14)11(8-10)4-3-7-13/h3,7,9-11H,4-6,8H2,1-2H3/b7-3+ |
| InChIKey | ZSOHARFAEZQFRI-XVNBXDOJSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |