C15H28O3S — CID 106727068
2-(2-tert-butylsulfonylethyl)-4-propan-2-ylcyclohexan-1-one (PubChem CID 106727068) has the molecular formula C15H28O3S and a molecular weight of 288.45 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-4-propan-2-ylcyclohexan-1-one.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 106727068 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-4-propan-2-ylcyclohexan-1-one |
| SMILES | CC(C)C1CCC(=O)C(CCS(=O)(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H28O3S/c1-11(2)12-6-7-14(16)13(10-12)8-9-19(17,18)15(3,4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | BUEUEUCSEOFJEK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |