C11H19ClO — CID 107900942
2-[(E)-3-chloroprop-2-enyl]-4-ethylcyclohexan-1-ol (PubChem CID 107900942) has the molecular formula C11H19ClO and a molecular weight of 202.72 g/mol. Its IUPAC name is 2-[(E)-3-chloroprop-2-enyl]-4-ethylcyclohexan-1-ol.
| Compound Name | 2-[(E)-3-chloroprop-2-enyl]-4-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107900942 |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[(E)-3-chloroprop-2-enyl]-4-ethylcyclohexan-1-ol |
| SMILES | CCC1CCC(O)C(C/C=C/Cl)C1 |
| InChI | InChI=1S/C11H19ClO/c1-2-9-5-6-11(13)10(8-9)4-3-7-12/h3,7,9-11,13H,2,4-6,8H2,1H3/b7-3+ |
| InChIKey | JESLXLRUXCSISQ-XVNBXDOJSA-N |
| XLogP | 3.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |