C14H28O2 — CID 114496727
4-ethyl-2-(2-hydroxy-2,3-dimethylbutyl)cyclohexan-1-ol (PubChem CID 114496727) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-ethyl-2-(2-hydroxy-2,3-dimethylbutyl)cyclohexan-1-ol.
| Compound Name | 4-ethyl-2-(2-hydroxy-2,3-dimethylbutyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114496727 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 4-ethyl-2-(2-hydroxy-2,3-dimethylbutyl)cyclohexan-1-ol |
| SMILES | CCC1CCC(O)C(CC(C)(O)C(C)C)C1 |
| InChI | InChI=1S/C14H28O2/c1-5-11-6-7-13(15)12(8-11)9-14(4,16)10(2)3/h10-13,15-16H,5-9H2,1-4H3 |
| InChIKey | YGDSZQLNSICJLV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |