C17H30N2 — CID 107901791
8-cyclopropyl-8-methyl-6-(3-methylbut-2-enyl)-6,9-diazaspiro[4.5]decane (PubChem CID 107901791) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 8-cyclopropyl-8-methyl-6-(3-methylbut-2-enyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-cyclopropyl-8-methyl-6-(3-methylbut-2-enyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 107901791 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 8-cyclopropyl-8-methyl-6-(3-methylbut-2-enyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CC(C)=CCN1CC(C)(C2CC2)NCC12CCCC2 |
| InChI | InChI=1S/C17H30N2/c1-14(2)8-11-19-13-16(3,15-6-7-15)18-12-17(19)9-4-5-10-17/h8,15,18H,4-7,9-13H2,1-3H3 |
| InChIKey | CPOJZRMBENAHRU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|