C14H26N2 — CID 64859833
2,5-dicyclopropyl-1-ethyl-2,5-dimethylpiperazine (PubChem CID 64859833) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 2,5-dicyclopropyl-1-ethyl-2,5-dimethylpiperazine.
| Compound Name | 2,5-dicyclopropyl-1-ethyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 64859833 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 2,5-dicyclopropyl-1-ethyl-2,5-dimethylpiperazine |
| SMILES | CCN1CC(C)(C2CC2)NCC1(C)C1CC1 |
| InChI | InChI=1S/C14H26N2/c1-4-16-10-13(2,11-5-6-11)15-9-14(16,3)12-7-8-12/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | JRPVBVUOXAYRTJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |