C13H26N2 — CID 107901957
3-ethyl-7-methyl-1-(3-methylbut-2-enyl)-1,4-diazepane (PubChem CID 107901957) has the molecular formula C13H26N2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 3-ethyl-7-methyl-1-(3-methylbut-2-enyl)-1,4-diazepane.
| Compound Name | 3-ethyl-7-methyl-1-(3-methylbut-2-enyl)-1,4-diazepane |
|---|---|
| PubChem CID | 107901957 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-ethyl-7-methyl-1-(3-methylbut-2-enyl)-1,4-diazepane |
| SMILES | CCC1CN(CC=C(C)C)C(C)CCN1 |
| InChI | InChI=1S/C13H26N2/c1-5-13-10-15(9-7-11(2)3)12(4)6-8-14-13/h7,12-14H,5-6,8-10H2,1-4H3 |
| InChIKey | OZZLYBQXGDKWAS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|