C24H43N7O2 — CID 10790199
N-[4-(3-aminopropylamino)butyl]-2-benzyl-N'-[6-(diaminomethylideneamino)hexyl]propanediamide (PubChem CID 10790199) has the molecular formula C24H43N7O2 and a molecular weight of 461.66 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]-2-benzyl-N'-[6-(diaminomethylideneamino)hexyl]propanediamide.
| Compound Name | N-[4-(3-aminopropylamino)butyl]-2-benzyl-N'-[6-(diaminomethylideneamino)hexyl]propanediamide |
|---|---|
| PubChem CID | 10790199 |
| Molecular Formula | C24H43N7O2 |
| Molecular Weight | 461.66 g/mol |
| Exact Mass | 461.35 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]-2-benzyl-N'-[6-(diaminomethylideneamino)hexyl]propanediamide |
| SMILES | NCCCNCCCCNC(=O)C(Cc1ccccc1)C(=O)NCCCCCCN=C(N)N |
| InChI | InChI=1S/C24H43N7O2/c25-13-10-15-28-14-8-9-17-30-23(33)21(19-20-11-4-3-5-12-20)22(32)29-16-6-1-2-7-18-31-24(26)27/h3-5,11-12,21,28H,1-2,6-10,13-19,25H2,(H,29,32)(H,30,33)(H4,26,27,31) |
| InChIKey | RJJUFMHSTYICFN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.66 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|