C14H22N2O2 — CID 107902022
6-cyclopropyl-3,6-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione (PubChem CID 107902022) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 6-cyclopropyl-3,6-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione.
| Compound Name | 6-cyclopropyl-3,6-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 107902022 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 6-cyclopropyl-3,6-dimethyl-1-(3-methylbut-2-enyl)piperazine-2,5-dione |
| SMILES | CC(C)=CCN1C(=O)C(C)NC(=O)C1(C)C1CC1 |
| InChI | InChI=1S/C14H22N2O2/c1-9(2)7-8-16-12(17)10(3)15-13(18)14(16,4)11-5-6-11/h7,10-11H,5-6,8H2,1-4H3,(H,15,18) |
| InChIKey | KTRRURWGYNDUGA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|