C17H23FO3 — CID 107908566
4-fluoro-2-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid (PubChem CID 107908566) has the molecular formula C17H23FO3 and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-fluoro-2-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid.
| Compound Name | 4-fluoro-2-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 107908566 |
| Molecular Formula | C17H23FO3 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 4-fluoro-2-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid |
| SMILES | CC1CC(OCc2cc(F)ccc2C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23FO3/c1-11-6-14(9-17(2,3)8-11)21-10-12-7-13(18)4-5-15(12)16(19)20/h4-5,7,11,14H,6,8-10H2,1-3H3,(H,19,20) |
| InChIKey | XXCNLMLIXDEHNF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |