C17H25NO3 — CID 104825404
2-amino-6-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid (PubChem CID 104825404) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-amino-6-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid.
| Compound Name | 2-amino-6-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 104825404 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-amino-6-[(3,3,5-trimethylcyclohexyl)oxymethyl]benzoic acid |
| SMILES | CC1CC(OCc2cccc(N)c2C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25NO3/c1-11-7-13(9-17(2,3)8-11)21-10-12-5-4-6-14(18)15(12)16(19)20/h4-6,11,13H,7-10,18H2,1-3H3,(H,19,20) |
| InChIKey | GSDIVVLGSYARLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|