C19H28O2 — CID 43793710
1-phenyl-4-(3,3,5-trimethylcyclohexyl)oxybutan-1-one (PubChem CID 43793710) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-phenyl-4-(3,3,5-trimethylcyclohexyl)oxybutan-1-one.
| Compound Name | 1-phenyl-4-(3,3,5-trimethylcyclohexyl)oxybutan-1-one |
|---|---|
| PubChem CID | 43793710 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-phenyl-4-(3,3,5-trimethylcyclohexyl)oxybutan-1-one |
| SMILES | CC1CC(OCCCC(=O)c2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H28O2/c1-15-12-17(14-19(2,3)13-15)21-11-7-10-18(20)16-8-5-4-6-9-16/h4-6,8-9,15,17H,7,10-14H2,1-3H3 |
| InChIKey | ZGNABFDERVXJHS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|