About 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane
3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane (PubChem CID 43165211) has the molecular formula C13H25BrO
and a molecular weight of 277.25 g/mol. Its IUPAC name is 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane.
Molecular Properties
| Compound Name | 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane |
| PubChem CID | 43165211 |
| Molecular Formula | C13H25BrO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane |
| SMILES | CC1CC(OCCCCBr)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25BrO/c1-11-8-12(10-13(2,3)9-11)15-7-5-4-6-14/h11-12H,4-10H2,1-3H3 |
| InChIKey | DYKNNEOEEGOMNA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane?
The IUPAC name of 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane (CID 43165211) is 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane.
What is the SMILES notation for 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane?
The canonical SMILES for 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane is CC1CC(OCCCCBr)CC(C)(C)C1.
What is the InChIKey of 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane?
The InChIKey is DYKNNEOEEGOMNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25BrO/c1-11-8-12(10-13(2,3)9-11)15-7-5-4-6-14/h11-12H,4-10H2,1-3H3.
What are the key properties of 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane?
3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane has a molecular weight of 277.25 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromobutoxy)-1,1,5-trimethylcyclohexane is sourced from PubChem (CID 43165211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).