C11H21BrN2O2 — CID 107908685
5-bromo-N-[1-oxo-1-(propylamino)propan-2-yl]pentanamide (PubChem CID 107908685) has the molecular formula C11H21BrN2O2 and a molecular weight of 293.21 g/mol. Its IUPAC name is 5-bromo-N-[1-oxo-1-(propylamino)propan-2-yl]pentanamide.
| Compound Name | 5-bromo-N-[1-oxo-1-(propylamino)propan-2-yl]pentanamide |
|---|---|
| PubChem CID | 107908685 |
| Molecular Formula | C11H21BrN2O2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 5-bromo-N-[1-oxo-1-(propylamino)propan-2-yl]pentanamide |
| SMILES | CCCNC(=O)C(C)NC(=O)CCCCBr |
| InChI | InChI=1S/C11H21BrN2O2/c1-3-8-13-11(16)9(2)14-10(15)6-4-5-7-12/h9H,3-8H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | OOJIHADYYUHAQO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|