C11H12FNO3S2 — CID 107909333
4-fluoro-2-(2-methylsulfonylethylsulfinylmethyl)benzonitrile (PubChem CID 107909333) has the molecular formula C11H12FNO3S2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-fluoro-2-(2-methylsulfonylethylsulfinylmethyl)benzonitrile.
| Compound Name | 4-fluoro-2-(2-methylsulfonylethylsulfinylmethyl)benzonitrile |
|---|---|
| PubChem CID | 107909333 |
| Molecular Formula | C11H12FNO3S2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 4-fluoro-2-(2-methylsulfonylethylsulfinylmethyl)benzonitrile |
| SMILES | CS(=O)(=O)CCS(=O)Cc1cc(F)ccc1C#N |
| InChI | InChI=1S/C11H12FNO3S2/c1-18(15,16)5-4-17(14)8-10-6-11(12)3-2-9(10)7-13/h2-3,6H,4-5,8H2,1H3 |
| InChIKey | UKOXKJNPMAUPRN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |