C14H8F3NOS — CID 107909381
2-[(3,4-difluorophenyl)sulfinylmethyl]-4-fluorobenzonitrile (PubChem CID 107909381) has the molecular formula C14H8F3NOS and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)sulfinylmethyl]-4-fluorobenzonitrile.
| Compound Name | 2-[(3,4-difluorophenyl)sulfinylmethyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 107909381 |
| Molecular Formula | C14H8F3NOS |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-[(3,4-difluorophenyl)sulfinylmethyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)cc1CS(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H8F3NOS/c15-11-2-1-9(7-18)10(5-11)8-20(19)12-3-4-13(16)14(17)6-12/h1-6H,8H2 |
| InChIKey | RMGIGHPRVZXBSQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |