C12H20N4O2 — CID 107911728
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]methanamine (PubChem CID 107911728) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]methanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 107911728 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]methanamine |
| SMILES | Cc1nc(CNCC2CN3CCCC3CO2)no1 |
| InChI | InChI=1S/C12H20N4O2/c1-9-14-12(15-18-9)6-13-5-11-7-16-4-2-3-10(16)8-17-11/h10-11,13H,2-8H2,1H3 |
| InChIKey | RQKIBJDDDSWIPS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |