C14H20BrN3O — CID 78961701
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-bromo-2-pyridinyl)methyl]methanamine (PubChem CID 78961701) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-bromo-2-pyridinyl)methyl]methanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-bromo-2-pyridinyl)methyl]methanamine |
|---|---|
| PubChem CID | 78961701 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(5-bromo-2-pyridinyl)methyl]methanamine |
| SMILES | Brc1ccc(CNCC2CN3CCCC3CO2)nc1 |
| InChI | InChI=1S/C14H20BrN3O/c15-11-3-4-12(17-6-11)7-16-8-14-9-18-5-1-2-13(18)10-19-14/h3-4,6,13-14,16H,1-2,5,7-10H2 |
| InChIKey | UKIRAPCTNKZLJO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |