C15H19BrF2N2O — CID 106263550
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(3-bromo-2,6-difluorophenyl)methyl]methanamine (PubChem CID 106263550) has the molecular formula C15H19BrF2N2O and a molecular weight of 361.23 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(3-bromo-2,6-difluorophenyl)methyl]methanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(3-bromo-2,6-difluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 106263550 |
| Molecular Formula | C15H19BrF2N2O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-[(3-bromo-2,6-difluorophenyl)methyl]methanamine |
| SMILES | Fc1ccc(Br)c(F)c1CNCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H19BrF2N2O/c16-13-3-4-14(17)12(15(13)18)7-19-6-11-8-20-5-1-2-10(20)9-21-11/h3-4,10-11,19H,1-2,5-9H2 |
| InChIKey | JMISKVTUGYJVJR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|