C15H21FN2O2 — CID 115951720
2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]-6-fluorophenol (PubChem CID 115951720) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]-6-fluorophenol.
| Compound Name | 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]-6-fluorophenol |
|---|---|
| PubChem CID | 115951720 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]-6-fluorophenol |
| SMILES | Oc1c(F)cccc1CNCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H21FN2O2/c16-14-5-1-3-11(15(14)19)7-17-8-13-9-18-6-2-4-12(18)10-20-13/h1,3,5,12-13,17,19H,2,4,6-10H2 |
| InChIKey | XATLQAJHGYNRGK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|