C16H23N3O2 — CID 79082416
2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]benzamide (PubChem CID 79082416) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]benzamide.
| Compound Name | 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 79082416 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-[(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethylamino)methyl]benzamide |
| SMILES | NC(=O)c1ccccc1CNCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H23N3O2/c17-16(20)15-6-2-1-4-12(15)8-18-9-14-10-19-7-3-5-13(19)11-21-14/h1-2,4,6,13-14,18H,3,5,7-11H2,(H2,17,20) |
| InChIKey | ZZWGGIYXLVOZHG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |