C23H28N2O2 — CID 52536724
N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2-phenylethyl)benzamide (PubChem CID 52536724) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 52536724 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2-phenylethyl)benzamide |
| SMILES | O=C(NC[C@@H]1CN2CCC[C@@H]2CO1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O2/c26-23(24-15-21-16-25-14-6-10-20(25)17-27-21)22-11-5-4-9-19(22)13-12-18-7-2-1-3-8-18/h1-5,7-9,11,20-21H,6,10,12-17H2,(H,24,26)/t20-,21-/m1/s1 |
| InChIKey | ZCJVIOSJTXTSII-NHCUHLMSSA-N |
| XLogP | 3.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |