C17H24N2O2 — CID 94820684
N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,3-dimethylbenzamide (PubChem CID 94820684) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,3-dimethylbenzamide.
| Compound Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 94820684 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)NC[C@H]2CN3CCC[C@@H]3CO2)c1C |
| InChI | InChI=1S/C17H24N2O2/c1-12-5-3-7-16(13(12)2)17(20)18-9-15-10-19-8-4-6-14(19)11-21-15/h3,5,7,14-15H,4,6,8-11H2,1-2H3,(H,18,20)/t14-,15+/m1/s1 |
| InChIKey | ZFVVWSGMUSWWNN-CABCVRRESA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |