C18H26N2O3 — CID 94817812
N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2,6-dimethylphenoxy)acetamide (PubChem CID 94817812) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2,6-dimethylphenoxy)acetamide.
| Compound Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 94817812 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(2,6-dimethylphenoxy)acetamide |
| SMILES | Cc1cccc(C)c1OCC(=O)NC[C@@H]1CN2CCC[C@@H]2CO1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-5-3-6-14(2)18(13)23-12-17(21)19-9-16-10-20-8-4-7-15(20)11-22-16/h3,5-6,15-16H,4,7-12H2,1-2H3,(H,19,21)/t15-,16-/m1/s1 |
| InChIKey | RVHABHYLPBBBTC-HZPDHXFCSA-N |
| XLogP | 1.66 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |