C18H27N3O4 — CID 95598167
1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(2,3-dimethoxyphenyl)methyl]urea (PubChem CID 95598167) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(2,3-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(2,3-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 95598167 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(2,3-dimethoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)NC[C@@H]2CN3CCC[C@@H]3CO2)c1OC |
| InChI | InChI=1S/C18H27N3O4/c1-23-16-7-3-5-13(17(16)24-2)9-19-18(22)20-10-15-11-21-8-4-6-14(21)12-25-15/h3,5,7,14-15H,4,6,8-12H2,1-2H3,(H2,19,20,22)/t14-,15-/m1/s1 |
| InChIKey | MKWCOAOAWIWWQC-HUUCEWRRSA-N |
| XLogP | 1.37 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |