C19H27N3O2 — CID 124840709
(2S,3R)-N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-methyl-2-phenylazetidine-1-carboxamide (PubChem CID 124840709) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2S,3R)-N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-methyl-2-phenylazetidine-1-carboxamide.
| Compound Name | (2S,3R)-N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-methyl-2-phenylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 124840709 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (2S,3R)-N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-methyl-2-phenylazetidine-1-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)NC[C@@H]2CN3CCC[C@H]3CO2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-11-22(18(14)15-6-3-2-4-7-15)19(23)20-10-17-12-21-9-5-8-16(21)13-24-17/h2-4,6-7,14,16-18H,5,8-13H2,1H3,(H,20,23)/t14-,16+,17-,18+/m1/s1 |
| InChIKey | KOVAIKOZRDEWSP-SPUZQDLCSA-N |
| XLogP | 2.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |